CAS 52371-33-2 is the registry number for rel-N-((1R,4S)-1,2,3,4-Tetrahydro-4-phenyl-1-naphthalenyl)acetamide. Offered by: TRC. Available pack sizes: 25mg.
N-[(1R,4S)-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (CAS 52371-33-2) is a chemical compound with the molecular formula C18H19NO and a molecular weight of 265.3 g/mol. IUPAC name: N-[(1R,4S)-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide. InChIKey: QEZIWGGQHNKCSH-MAUKXSAKSA-N.
| Molecular formula | C18H19NO |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | N-[(1R,4S)-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| InChIKey | QEZIWGGQHNKCSH-MAUKXSAKSA-N |
| SMILES | CC(=O)N[C@@H]1CC[C@H](C2=CC=CC=C12)C3=CC=CC=C3 |
Computed by PubChem (NCBI)