CAS 523980-04-3 is the registry number for 1-((2,3-Dichlorophenyl)methyl)piperazine. Offered by: Biosynth. Available pack sizes: 2,5g.
1-[(2,3-dichlorophenyl)methyl]piperazine (CAS 523980-04-3) is a chemical compound with the molecular formula C11H14Cl2N2 and a molecular weight of 245.14 g/mol. IUPAC name: 1-[(2,3-dichlorophenyl)methyl]piperazine. InChIKey: LFMDJDXSAUVJHV-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 1-[(2,3-dichlorophenyl)methyl]piperazine |
| InChIKey | LFMDJDXSAUVJHV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)