Products 524005-41-2
CAS 524005-41-2 is the registry number for 5-fluoro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid, ≥98.6%. Offered by: Chemat. Available pack sizes: 1g.
5-fluoro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid (CAS 524005-41-2) is a chemical compound with the molecular formula C9H7FO4 and a molecular weight of 198.15 g/mol. IUPAC name: 5-fluoro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid. InChIKey: RIVSCDAHAOCSFS-UHFFFAOYSA-N.
| Molecular formula | C9H7FO4 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid |
| InChIKey | RIVSCDAHAOCSFS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2F)C(=O)O |
Computed by PubChem (NCBI)