CAS 52414-97-8 appears in our catalog under these names: 1-Bromo-3-methyl-2-nitrobenzene, 97%, 97%, 1-Bromo-3-methyl-2-nitrobenzene 97%, 3-Bromo-2-nitrotoluene, 98%. Offered by: Chemat, Ambeed, Fluorochem. Available pack sizes: 10g, 100g, 1g, 5g, 25g.
1-bromo-3-methyl-2-nitrobenzene (CAS 52414-97-8) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 1-bromo-3-methyl-2-nitrobenzene. InChIKey: XDKMDDOCVPNVMB-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1-bromo-3-methyl-2-nitrobenzene |
| InChIKey | XDKMDDOCVPNVMB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)