Products 52476-65-0
CAS 52476-65-0 is the registry number for 4-Chloro-6-(3,5-dimethyl-1H-pyrazol-1-yl)pyrimidine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-chloro-6-(3,5-dimethylpyrazol-1-yl)pyrimidine (CAS 52476-65-0) is a chemical compound with the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. IUPAC name: 4-chloro-6-(3,5-dimethylpyrazol-1-yl)pyrimidine. InChIKey: OPJLBGHHFRSYPN-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4 |
|---|---|
| Molecular weight | 208.65 g/mol |
| IUPAC name | 4-chloro-6-(3,5-dimethylpyrazol-1-yl)pyrimidine |
| InChIKey | OPJLBGHHFRSYPN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC(=NC=N2)Cl)C |
Computed by PubChem (NCBI)