Products 52488-28-5
CAS 52488-28-5 appears in our catalog under these names: 3-Bromo-5-nitrotoluene, 97%, 1-Bromo-3-methyl-5-nitrobenzene 98%, 1-bromo-3-methyl-5-nitrobenzene, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1g.
1-bromo-3-methyl-5-nitrobenzene (CAS 52488-28-5) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 1-bromo-3-methyl-5-nitrobenzene. InChIKey: MWFDNXJPZUOTJB-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1-bromo-3-methyl-5-nitrobenzene |
| InChIKey | MWFDNXJPZUOTJB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)