CAS 52498-32-5 appears in our catalog under these names: Boc–N–Me–Ile–OH, Boc-L-MeIle-OH, Boc-N-Me-Ile-OH 95%, L-Isoleucine, N-[(1,1-dimethylethoxy)carbonyl]-N-methyl-, 98%, 98%, Boc-N-methyl-L-isoleucine, 98.08%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 500g, 100mg, 250mg.
(2S,3S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (CAS 52498-32-5) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2S,3S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid. InChIKey: HTBIAUMDQYXOFG-IUCAKERBSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
| InChIKey | HTBIAUMDQYXOFG-IUCAKERBSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)