Products 52498-82-5
CAS 52498-82-5 is the registry number for (4-Chlorophenyl)-(2-methylindol-1-yl)methanone. Offered by: Biosynth. Available pack sizes: 10g, 25g, 50g.
(4-chlorophenyl)-(2-methylindol-1-yl)methanone (CAS 52498-82-5) is a chemical compound with the molecular formula C16H12ClNO and a molecular weight of 269.72 g/mol. IUPAC name: (4-chlorophenyl)-(2-methylindol-1-yl)methanone. InChIKey: CDOATHCMQATAKB-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | (4-chlorophenyl)-(2-methylindol-1-yl)methanone |
| InChIKey | CDOATHCMQATAKB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC=CC=C2N1C(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)