Products 5252-98-2
CAS 5252-98-2 appears in our catalog under these names: 4,5-Dichloro-2-methylbenzoic acid, 98%, 4，5–Dichloro–2–methylbenzoic acid, 4,5-Dichloro-2-methylbenzoic acid, 4,5-Dichloro-2-methylbenzoic acid 97%, 4,5-Dichloro-2-methylbenzoic acid, 97%, 97%. Offered by: Fluorochem, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
4,5-dichloro-2-methylbenzoic acid (CAS 5252-98-2) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 4,5-dichloro-2-methylbenzoic acid. InChIKey: DUULAHGVYKMTME-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 4,5-dichloro-2-methylbenzoic acid |
| InChIKey | DUULAHGVYKMTME-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)