CAS 52531-22-3 appears in our catalog under these names: 4-Methylindole-3-acetic Acid, 2-(4-Methyl-1H-indol-3-yl)acetic acid, 2-(4-Methyl-1H-indol-3-yl)acetic acid 98%, 2-(4-Methyl-1h-indol-3-yl)acetic acid, 98%, 98%, 2-(4-Methyl-1H-indol-3-yl)acetic acid, 97%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg.
2-(4-methyl-1H-indol-3-yl)acetic acid (CAS 52531-22-3) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-(4-methyl-1H-indol-3-yl)acetic acid. InChIKey: HCJHZUYDCZGMHA-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-(4-methyl-1H-indol-3-yl)acetic acid |
| InChIKey | HCJHZUYDCZGMHA-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)NC=C2CC(=O)O |
Computed by PubChem (NCBI)