CAS 525574-81-6 appears in our catalog under these names: 5–Chloro–3–(2–fluorophenyl)–1,2,4–oxadiazole, 5-Chloro-3-(2-fluorophenyl)-1,2,4-oxadiazole, 96%, 96%, 5-Chloro-3-(2-fluorophenyl)-1,2,4-oxadiazole, 96%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-3-(2-fluorophenyl)-1,2,4-oxadiazole (CAS 525574-81-6) is a chemical compound with the molecular formula C8H4ClFN2O and a molecular weight of 198.58 g/mol. IUPAC name: 5-chloro-3-(2-fluorophenyl)-1,2,4-oxadiazole. InChIKey: SGIXUDYJVLXHJP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O |
|---|---|
| Molecular weight | 198.58 g/mol |
| IUPAC name | 5-chloro-3-(2-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | SGIXUDYJVLXHJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)Cl)F |
Computed by PubChem (NCBI)