CAS 525593-33-3 appears in our catalog under these names: 3-Bromo-5-nitroindole, 95%, 3-Bromo-5-nitroindole, 97%, 97%, 3-Bromo-5-nitro-1H-indole, 97%. Offered by: Fluorochem, Chemat, Combi-blocks. Available pack sizes: 5g, 10g, 25g, 250mg, 1g.
3-bromo-5-nitro-1H-indole (CAS 525593-33-3) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 3-bromo-5-nitro-1H-indole. InChIKey: LBTWTOYAMQQAKO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 3-bromo-5-nitro-1H-indole |
| InChIKey | LBTWTOYAMQQAKO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CN2)Br |
Computed by PubChem (NCBI)