CAS 5256-74-6 appears in our catalog under these names: Diethyl 2–Diazomalonate, 1,3-Diethyl 2-diazopropanedioate, 1,3-Diethyl 2-diazopropanedioate, >97%, >97%, 1,3-diethyl 2-diazopropanedioate, >97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 0,5g, 5g, 1g, 10g, 100mg, 25g.
Diethyl 2-diazopropanedioate (CAS 5256-74-6) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: diethyl 2-diazopropanedioate. InChIKey: PSINDLUNOGABJV-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | diethyl 2-diazopropanedioate |
| InChIKey | PSINDLUNOGABJV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(=O)OCC |
Computed by PubChem (NCBI)