Products 52602-39-8
CAS 52602-39-8 appears in our catalog under these names: Carvedilol Impurity 22, 4-Hydroxy Carbazole, >95% (HPLC), 4-Hydroxycarbazole, 4–Hydroxycarbazole, 4-Hydroxy carbazole. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 1g, 25mg, 100g, 500g, 5g, 25g, 250g.
9H-carbazol-4-ol (CAS 52602-39-8) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 9H-carbazol-4-ol. InChIKey: UEOHATPGKDSULR-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 9H-carbazol-4-ol |
| InChIKey | UEOHATPGKDSULR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC=C3O |
Computed by PubChem (NCBI)