CAS 52648-13-2 appears in our catalog under these names: Tryptamine Impurity 2, 3-(2-Aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid, 3-(2-Aminoethyl)-5-methoxy-1h-indole-2-carboxylic acid, 95%, 3-(2-Aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid, 97%, 3-(2-Aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid 95%. Offered by: Chemat Brand, Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: on request, 250mg, 500mg, 1000mg, 2000mg, 100mg, 1g, 10g.
3-(2-aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid (CAS 52648-13-2) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 3-(2-aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid. InChIKey: FBEQOUNJJYSFJU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 3-(2-aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid |
| InChIKey | FBEQOUNJJYSFJU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2CCN)C(=O)O |
Computed by PubChem (NCBI)