CAS 52761-10-1 is the registry number for 2–(2–bromo–5–nitrophenyl)acetonitrile. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-(2-bromo-5-nitrophenyl)acetonitrile (CAS 52761-10-1) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 2-(2-bromo-5-nitrophenyl)acetonitrile. InChIKey: LZTIMLRTOYLPAQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 2-(2-bromo-5-nitrophenyl)acetonitrile |
| InChIKey | LZTIMLRTOYLPAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CC#N)Br |
Computed by PubChem (NCBI)