Products 52771-99-0
CAS 52771-99-0 appears in our catalog under these names: 5-Nitro-1,3-dihydroisobenzofuran, 95%, 5-Nitro-1,3-dihydroisobenzofuran, 95+%, 5–Nitro–1，3–dihydroisobenzofuran. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-nitro-1,3-dihydro-2-benzofuran (CAS 52771-99-0) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 5-nitro-1,3-dihydro-2-benzofuran. InChIKey: VZIBAMYIHSHADC-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 5-nitro-1,3-dihydro-2-benzofuran |
| InChIKey | VZIBAMYIHSHADC-UHFFFAOYSA-N |
| SMILES | C1C2=C(CO1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)