Products 5278-91-1
CAS 5278-91-1 appears in our catalog under these names: 4-dichloromethyl benzoic acid, 4-(Dichloromethyl)benzoic acid 95%, 4-(Dichloromethyl)benzoic acid, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4-(dichloromethyl)benzoic acid (CAS 5278-91-1) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 4-(dichloromethyl)benzoic acid. InChIKey: ZBWFBZYDFGYXIG-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 4-(dichloromethyl)benzoic acid |
| InChIKey | ZBWFBZYDFGYXIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)