Products 52803-69-7
CAS 52803-69-7 appears in our catalog under these names: 2-(4-Chloro-benzyloxy)-benzoic acid, 95%, 2-((4-Chlorobenzyl)oxy)benzoic acid, 95%, 2-((4-Chlorobenzyl)oxy)benzoic acid, 2-((4-Chlorobenzyl)oxy)benzoic acid 95%, 2-((4-Chlorobenzyl)oxy)benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-[(4-chlorophenyl)methoxy]benzoic acid (CAS 52803-69-7) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 2-[(4-chlorophenyl)methoxy]benzoic acid. InChIKey: UMIRGIHRCRAJPI-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methoxy]benzoic acid |
| InChIKey | UMIRGIHRCRAJPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)