Products 20292-28-8
CAS 20292-28-8 appears in our catalog under these names: [(3-Chloro-1,1'-biphenyl-4-yl)oxy]acetic acid, 95%, 2-((3-Chloro-(1,1'-biphenyl)-4-yl)oxy)acetic acid, 97%, 2-(2-Chloro-4-phenylphenoxy)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-(2-chloro-4-phenylphenoxy)acetic acid (CAS 20292-28-8) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 2-(2-chloro-4-phenylphenoxy)acetic acid. InChIKey: UQRLYDDCHNEFAP-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-(2-chloro-4-phenylphenoxy)acetic acid |
| InChIKey | UQRLYDDCHNEFAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)OCC(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(2-chloro-4-phenylphenoxy)acetic acid, [(3-chloro-1,1'-biphenyl-4-yl)oxy]acetic acid, 2-((3-Chloro-[1,1'-biphenyl]-4-yl)oxy)acetic acid, Acetic acid, 2-[(3-chloro[1,1'-biphenyl]-4-yl)oxy]-, 2-(2-chloro-4-phenyl-phenoxy)acetic Acid, [(3-Chloro[1,1'-biphenyl]-4-yl)oxy]acetic acid, 2-((3-Chloro-[1,1'-biphenyl]-4-yl)oxy)aceticacid