Products 52803-70-0
CAS 52803-70-0 appears in our catalog under these names: 2-[(2-Chlorobenzyl)oxy]benzoic acid, 95%, 2-((2-Chlorobenzyl)oxy)benzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(2-chlorophenyl)methoxy]benzoic acid (CAS 52803-70-0) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 2-[(2-chlorophenyl)methoxy]benzoic acid. InChIKey: WIMYONIKOLZLBM-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methoxy]benzoic acid |
| InChIKey | WIMYONIKOLZLBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=CC=C2C(=O)O)Cl |
Computed by PubChem (NCBI)