Products 1215206-24-8

CAS 1215206-24-8 is the registry number for 2'-Chloro-3'-methoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(2-chloro-3-methoxyphenyl)benzoic acid (CAS 1215206-24-8) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 3-(2-chloro-3-methoxyphenyl)benzoic acid. InChIKey: DRYXFJQEEDVSFI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO3
Molecular weight262.69 g/mol
IUPAC name3-(2-chloro-3-methoxyphenyl)benzoic acid
InChIKeyDRYXFJQEEDVSFI-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1Cl)C2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)