Products 52900-79-5
CAS 52900-79-5 is the registry number for 2,3-furandicarboxylic acid dimethyl ester, 95%. Offered by: Chemat. Available pack sizes: 1g.
Dimethyl furan-2,3-dicarboxylate (CAS 52900-79-5) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: dimethyl furan-2,3-dicarboxylate. InChIKey: FXJUUMGKLWHCNZ-UHFFFAOYSA-N.
| Molecular formula | C8H8O5 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | dimethyl furan-2,3-dicarboxylate |
| InChIKey | FXJUUMGKLWHCNZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(OC=C1)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Furandicarboxylic acid, dimethyl ester, dimethyl furan-2,3-dicarboxylate, Furan-2,3-dicarboxylic acid dimethyl ester, 2,3-Furandicarboxylic acid dimethyl ester, 2,3-Dimethyl furan-2,3-dicarboxylate, 2,3-Furandicarboxylic acid, dimethyl ester, FXJUUMGKLWHCNZ-UHFFFAOYSA-N, furandicarboxylic acid dimethyl ester, methyl 3-methoxycarbonylfuran-2-carboxylate