CAS 52939-33-0 appears in our catalog under these names: H-MePhe(4-Meo)-OH, 98%, N–Me–Tyr(Me)–OH, N-Methyl-O-methyl-L-tyrosine hydrochloride, (S)-3-(4-Methoxyphenyl)-2-(methylamino)propanoic acid, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg, 1000mg, 2000mg.
(2S)-3-(4-methoxyphenyl)-2-(methylamino)propanoic acid (CAS 52939-33-0) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2S)-3-(4-methoxyphenyl)-2-(methylamino)propanoic acid. InChIKey: QESMMBKGCOSBNL-JTQLQIEISA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2S)-3-(4-methoxyphenyl)-2-(methylamino)propanoic acid |
| InChIKey | QESMMBKGCOSBNL-JTQLQIEISA-N |
| SMILES | CN[C@@H](CC1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)