CAS 52979-42-7 appears in our catalog under these names: 6-Amino-1,4-dihydro-4-oxo-2-quinolinecarboxylic acid methyl ester, 95%, Methyl 6-amino-4-oxo-1,4-dihydroquinoline-2-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Methyl 6-amino-4-oxo-1H-quinoline-2-carboxylate (CAS 52979-42-7) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: methyl 6-amino-4-oxo-1H-quinoline-2-carboxylate. InChIKey: LTCKDZAUNSZESX-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | methyl 6-amino-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | LTCKDZAUNSZESX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C=CC(=C2)N |
Computed by PubChem (NCBI)