CAS 530-59-6 appears in our catalog under these names: Sinapinic Acid/ 99.92% (existing batch purity), Sinapinic acid (Sinapic acid), 4-Hydroxy-3,5-dimethoxycinnamic acid, 98% , Sinapinic acid, 3,5-Dimethoxy-4-hydroxycinnamic Acid, >98.0%(GC)(T). Offered by: TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100mg, 1g, 5g, 25g, 50g, 100g, 250g, 500g.
3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid (CAS 530-59-6) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid. InChIKey: PCMORTLOPMLEFB-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | PCMORTLOPMLEFB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)C=CC(=O)O |
Computed by PubChem (NCBI)