Products 53001-71-1
CAS 53001-71-1 appears in our catalog under these names: 2,3,4,5–Tetrafluorobenzyl Bromide, 2,3,4,5-Tetrafluorobenzyl bromide, ≥97%, 2,3,4,5-Tetrafluorobenzyl Bromide, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg.
1-(bromomethyl)-2,3,4,5-tetrafluorobenzene (CAS 53001-71-1) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 1-(bromomethyl)-2,3,4,5-tetrafluorobenzene. InChIKey: WTKVWOHBTGWNEO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 1-(bromomethyl)-2,3,4,5-tetrafluorobenzene |
| InChIKey | WTKVWOHBTGWNEO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)CBr |
Computed by PubChem (NCBI)