Products 53001-74-4
CAS 53001-74-4 appears in our catalog under these names: 2,3,4,5-Tetrafluorophenylacetonitrile 95%, 2,3,4,5-Tetrafluorophenylacetonitrile, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(2,3,4,5-tetrafluorophenyl)acetonitrile (CAS 53001-74-4) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 2-(2,3,4,5-tetrafluorophenyl)acetonitrile. InChIKey: XJZKJYAPEYUEHS-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 2-(2,3,4,5-tetrafluorophenyl)acetonitrile |
| InChIKey | XJZKJYAPEYUEHS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)CC#N |
Computed by PubChem (NCBI)