CAS 53011-72-6 is the registry number for Murralongin. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 500mg, 1mg, 10 mg, 1 mg, 5 mg, 25 mg.
2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal (CAS 53011-72-6) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal. InChIKey: PBAZKMWQUBDDLZ-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal |
| InChIKey | PBAZKMWQUBDDLZ-UHFFFAOYSA-N |
| SMILES | CC(=C(C=O)C1=C(C=CC2=C1OC(=O)C=C2)OC)C |
Computed by PubChem (NCBI)