Products 53011-72-6

CAS 53011-72-6 is the registry number for Murralongin. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 500mg, 1mg, 10 mg, 1 mg, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal (CAS 53011-72-6) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal. InChIKey: PBAZKMWQUBDDLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O4
Molecular weight258.27 g/mol
IUPAC name2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal
InChIKeyPBAZKMWQUBDDLZ-UHFFFAOYSA-N
SMILESCC(=C(C=O)C1=C(C=CC2=C1OC(=O)C=C2)OC)C

Computed by PubChem (NCBI)