Products 53086-45-6

CAS 53086-45-6 is the registry number for 3-(3-Bromophenyl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(3-bromophenyl)butanoic acid (CAS 53086-45-6) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 3-(3-bromophenyl)butanoic acid. InChIKey: CVXWVKRMNAFDGY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO2
Molecular weight243.10 g/mol
IUPAC name3-(3-bromophenyl)butanoic acid
InChIKeyCVXWVKRMNAFDGY-UHFFFAOYSA-N
SMILESCC(CC(=O)O)C1=CC(=CC=C1)Br

Computed by PubChem (NCBI)