Products 531501-41-4
CAS 531501-41-4 appears in our catalog under these names: 6-Bromo-7-hydroxy-2,2-dimethyl-4H-benzo[d][1,3]dioxin-4-one, 97%, 97%, 6-BROMO-7-HYDROXY-2,2-DIMETHYL-BENZO[1,3]DIOXIN-4-ONE, 97%, 6-Bromo-7-hydroxy-2,2-dimethyl-4H-benzo[d][1,3]dioxin-4-one, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one (CAS 531501-41-4) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: 6-bromo-7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one. InChIKey: FOZVJTHORLMHQD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 6-bromo-7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one |
| InChIKey | FOZVJTHORLMHQD-UHFFFAOYSA-N |
| SMILES | CC1(OC2=CC(=C(C=C2C(=O)O1)Br)O)C |
Computed by PubChem (NCBI)