Products 53163-55-6
CAS 53163-55-6 appears in our catalog under these names: (2E,4E,6E,8E,10E)-Diethyl 4,9-dimethyldodeca-2,4,6,8,10-pentaenedioate, 95%, 95%, (2E,4E,6E,8E,10E)-Diethyl 4,9-dimethyldodeca-2,4,6,8,10-pentaenedioate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Diethyl (2E,4E,6E,8E,10E)-4,9-dimethyldodeca-2,4,6,8,10-pentaenedioate (CAS 53163-55-6) is a chemical compound with the molecular formula C18H24O4 and a molecular weight of 304.4 g/mol. IUPAC name: diethyl (2E,4E,6E,8E,10E)-4,9-dimethyldodeca-2,4,6,8,10-pentaenedioate. InChIKey: DDYKQJBQCHMVOY-ZIPQNXPMSA-N.
| Molecular formula | C18H24O4 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | diethyl (2E,4E,6E,8E,10E)-4,9-dimethyldodeca-2,4,6,8,10-pentaenedioate |
| InChIKey | DDYKQJBQCHMVOY-ZIPQNXPMSA-N |
| SMILES | CCOC(=O)/C=C/C(=C/C=C/C=C(/C=C/C(=O)OCC)\C)/C |
Computed by PubChem (NCBI)