Products 53207-34-4
CAS 53207-34-4 is the registry number for 3-(Dimethylamino)-2,2-dimethyl-1-phenylpropan-1-one maleate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(Z)-but-2-enedioic acid;3-(dimethylamino)-2,2-dimethyl-1-phenylpropan-1-one (CAS 53207-34-4) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;3-(dimethylamino)-2,2-dimethyl-1-phenylpropan-1-one. InChIKey: INVKKPIHHZVENS-BTJKTKAUSA-N.
| Molecular formula | C17H23NO5 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;3-(dimethylamino)-2,2-dimethyl-1-phenylpropan-1-one |
| InChIKey | INVKKPIHHZVENS-BTJKTKAUSA-N |
| SMILES | CC(C)(CN(C)C)C(=O)C1=CC=CC=C1.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)