CAS 5326-38-5 appears in our catalog under these names: 2–Iodo–5–nitrotoluene, 2-Iodo-5-nitrotoluene, 98%, 2-Iodo-5-nitrotoluene, >96.0%(GC), 1-Iodo-2-methyl-4-nitrobenzene 98%, 1-Iodo-2-methyl-4-nitrobenzene, 98%, 98%. Offered by: GLPBio, Fluorochem, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 10g, 500g, 5g.
1-iodo-2-methyl-4-nitrobenzene (CAS 5326-38-5) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 1-iodo-2-methyl-4-nitrobenzene. InChIKey: ARJHCXYRCLMLQN-UHFFFAOYSA-N.
| Molecular formula | C7H6INO2 |
|---|---|
| Molecular weight | 263.03 g/mol |
| IUPAC name | 1-iodo-2-methyl-4-nitrobenzene |
| InChIKey | ARJHCXYRCLMLQN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)