CAS 5327-72-0 appears in our catalog under these names: 1,4–Diaminoanthracene–9,10–diol, 1,4-Diaminoanthracene-9,10-diol, 95%, 95%, 1,4-DIAMINOANTHRACENE-9,10-DIOL, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg.
1,4-diaminoanthracene-9,10-diol (CAS 5327-72-0) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 1,4-diaminoanthracene-9,10-diol. InChIKey: WGOXABJBDOYQFK-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1,4-diaminoanthracene-9,10-diol |
| InChIKey | WGOXABJBDOYQFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C(=CC=C(C3=C2O)N)N)O |
Computed by PubChem (NCBI)