CAS 53308-95-5 appears in our catalog under these names: Boc–Nva–OH, Boc-L-Nva-OH, N-(tert-Butoxycarbonyl)-L-norvaline, >95.0%(HPLC), Boc-Nva-OH, 98%, 98%, Boc-Nva-OH, 98.0%. Offered by: GLPBio, Iris Biotech, TCI, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 50g, 500g, 25 g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 53308-95-5) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: INWOAUUPYIXDHN-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | INWOAUUPYIXDHN-ZETCQYMHSA-N |
| SMILES | CCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)