CAS 57521-85-4 appears in our catalog under these names: Boc–D–Nva–OH, (R)-2-((tert-Butoxycarbonyl)amino)pentanoic acid, 95%, 95%, (R)-2-((tert-Butoxycarbonyl)amino)pentanoic acid, 97.0%, Boc-D-Norvaline, 95%, Boc-D-Nva-OH, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 10 g, 100 g, 25 g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 57521-85-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: INWOAUUPYIXDHN-SSDOTTSWSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | INWOAUUPYIXDHN-SSDOTTSWSA-N |
| SMILES | CCC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)