CAS 5333-13-1 appears in our catalog under these names: 3-Bromo-2,4,6-trimethylbenzoic acid, 97%, 3-Bromo-2,4,6-trimethylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-bromo-2,4,6-trimethylbenzoic acid (CAS 5333-13-1) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 3-bromo-2,4,6-trimethylbenzoic acid. InChIKey: VUVHCRZIUORPEG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 3-bromo-2,4,6-trimethylbenzoic acid |
| InChIKey | VUVHCRZIUORPEG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)O)C)Br)C |
Computed by PubChem (NCBI)