Products 53377-61-0
CAS 53377-61-0 is the registry number for 1,3,5-Trihydroxy-4-prenylxanthone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 2mg, 5mg, Get quote.
1,3,5-trihydroxy-4-(3-methylbut-2-enyl)xanthen-9-one (CAS 53377-61-0) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 1,3,5-trihydroxy-4-(3-methylbut-2-enyl)xanthen-9-one. InChIKey: JCHQJCJKSHNCBA-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 1,3,5-trihydroxy-4-(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | JCHQJCJKSHNCBA-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C3=C(O2)C(=CC=C3)O)C |
Computed by PubChem (NCBI)