CAS 53389-01-8 appears in our catalog under these names: Diethyl 4–chloropyridine–2,6–dicarboxylate, Diethyl 4-Chloropyridine-2,6-Dicarboxylate, 98%, 98%, Diethyl 4-chloro-2,6-pyridinedicarboxylate, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg.
Diethyl 4-chloropyridine-2,6-dicarboxylate (CAS 53389-01-8) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: diethyl 4-chloropyridine-2,6-dicarboxylate. InChIKey: XQVRVZXJZVVBLW-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | diethyl 4-chloropyridine-2,6-dicarboxylate |
| InChIKey | XQVRVZXJZVVBLW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=N1)C(=O)OCC)Cl |
Computed by PubChem (NCBI)