CAS 53416-46-9 appears in our catalog under these names: 2-(4-Methoxyphenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole, 98%, 2–(4–Methoxyphenyl)–4,4–dimethyl–4,5–dihydrooxazole, 2-(4-Methoxyphenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole, 97%, 97%, 2-(4-Methoxyphenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
2-(4-methoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 53416-46-9) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 2-(4-methoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: HQVCWVGSZXODRW-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | HQVCWVGSZXODRW-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)