CAS 5344-88-7 appears in our catalog under these names: Benzil monohydrazone, 95%, (2E)-2-hydrazinylidene-1,2-diphenylethan-1-one, 1,2-Diphenyl-1,2-ethanedione 1-hydrazone, 97%(LC-MS),RG, 97%(LC-MS),RG. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 10g, 1g, 2,5g, 25g, 50g, 250g.
(2E)-2-hydrazinylidene-1,2-diphenylethanone (CAS 5344-88-7) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: (2E)-2-hydrazinylidene-1,2-diphenylethanone. InChIKey: CDQPGWNBSOSEMZ-DTQAZKPQSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | (2E)-2-hydrazinylidene-1,2-diphenylethanone |
| InChIKey | CDQPGWNBSOSEMZ-DTQAZKPQSA-N |
| SMILES | C1=CC=C(C=C1)/C(=N\N)/C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)