CAS 5351-85-9 is the registry number for Piperonalthiosemicarbazone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(E)-1,3-benzodioxol-5-ylmethylideneamino]thiourea (CAS 5351-85-9) is a chemical compound with the molecular formula C9H9N3O2S and a molecular weight of 223.25 g/mol. IUPAC name: [(E)-1,3-benzodioxol-5-ylmethylideneamino]thiourea. InChIKey: XPZMHSMUMPMPMD-NYYWCZLTSA-N.
| Molecular formula | C9H9N3O2S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | [(E)-1,3-benzodioxol-5-ylmethylideneamino]thiourea |
| InChIKey | XPZMHSMUMPMPMD-NYYWCZLTSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=N/NC(=S)N |
Computed by PubChem (NCBI)