CAS 53622-83-6 is the registry number for (R)-1-Methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol (CAS 53622-83-6) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol. InChIKey: IBRKLUSXDYATLG-ZCFIWIBFSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| InChIKey | IBRKLUSXDYATLG-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1C2=CC(=C(C=C2CCN1)O)O |
Computed by PubChem (NCBI)