CAS 53715-96-1 appears in our catalog under these names: 3,4,7-Trimethyl-1-benzofuran-2-carboxylic acid, 3,4,7-Trimethyl-1-benzofuran-2-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 10g.
3,4,7-trimethyl-1-benzofuran-2-carboxylic acid (CAS 53715-96-1) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 3,4,7-trimethyl-1-benzofuran-2-carboxylic acid. InChIKey: RCCSQBNWYYICDI-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3,4,7-trimethyl-1-benzofuran-2-carboxylic acid |
| InChIKey | RCCSQBNWYYICDI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(OC2=C(C=C1)C)C(=O)O)C |
Computed by PubChem (NCBI)