CAS 53750-06-4 is the registry number for 3-Methyl-3-phenylcyclopentanone, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-methyl-3-phenylcyclopentan-1-one (CAS 53750-06-4) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 3-methyl-3-phenylcyclopentan-1-one. InChIKey: RGOAWKBPBSKZML-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 3-methyl-3-phenylcyclopentan-1-one |
| InChIKey | RGOAWKBPBSKZML-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)