Products 537657-97-9
CAS 537657-97-9 appears in our catalog under these names: 3-(2-Oxo-1,3-oxazolidin-3-yl)benzoic acid, 95%, Benzoic acid, 3-(2-oxo-3-oxazolidinyl)-, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(2-oxo-1,3-oxazolidin-3-yl)benzoic acid (CAS 537657-97-9) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 3-(2-oxo-1,3-oxazolidin-3-yl)benzoic acid. InChIKey: KETFZTDHSKCSAT-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 3-(2-oxo-1,3-oxazolidin-3-yl)benzoic acid |
| InChIKey | KETFZTDHSKCSAT-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)