Products 537693-30-4

CAS 537693-30-4 is the registry number for 2-(3,4-Dihydro-2,4-dioxo-1(2H)-quinazolinyl)benzoic Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

2-(2,4-dioxoquinazolin-1-yl)benzoic acid (CAS 537693-30-4) is a chemical compound with the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. IUPAC name: 2-(2,4-dioxoquinazolin-1-yl)benzoic acid. InChIKey: AQDIPTUVOCVNKW-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10N2O4
Molecular weight282.25 g/mol
IUPAC name2-(2,4-dioxoquinazolin-1-yl)benzoic acid
InChIKeyAQDIPTUVOCVNKW-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)NC(=O)N2C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)