Products 538-58-9
CAS 538-58-9 appears in our catalog under these names: 1,5–Diphenyl–1,4–Pentadien–3–One, Dibenzylideneacetone, Dibenzylideneacetone, 99.71%, 1,5-Diphenylpenta-1,4-dien-3-one, 98%, Dibenzylideneacetone 98%. Offered by: GLPBio, Biosynth, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100g, 500g, 1kg, 5 g, 10mM/1mL, 25g, 50g, 1000g.
(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one (CAS 538-58-9) is a chemical compound with the molecular formula C17H14O and a molecular weight of 234.29 g/mol. IUPAC name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one. InChIKey: WMKGGPCROCCUDY-PHEQNACWSA-N.
| Molecular formula | C17H14O |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one |
| InChIKey | WMKGGPCROCCUDY-PHEQNACWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
trans,trans-Dibenzylideneacetone, Dibenzalacetone, Distyryl ketone, 1,5-Diphenyl-1,4-pentadien-3-one, (1E,4E)-1,5-Diphenyl-1,4-pentadien-3-one, 1,4-Pentadien-3-one, 1,5-diphenyl-, (E,E)-, Dibenzylideneacetone, (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one, trans,trans-Dibenzalacetone, 1,4-Pentadien-3-one, 1,5-diphenyl-, (1E,4E)-