CAS 53811-49-7 is the registry number for Norsanguinarine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
Benzo[f][1,3]benzodioxol-5-amine (CAS 53811-49-7) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: benzo[f][1,3]benzodioxol-5-amine. InChIKey: AGPMRJMONHLOAF-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | benzo[f][1,3]benzodioxol-5-amine |
| InChIKey | AGPMRJMONHLOAF-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C=CC=C3N |
Computed by PubChem (NCBI)